C15H17F4NO — CID 79645567
N-ethyl-1-(2-ethyl-1-benzofuran-3-yl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 79645567) has the molecular formula C15H17F4NO and a molecular weight of 303.30 g/mol. Its IUPAC name is N-ethyl-1-(2-ethyl-1-benzofuran-3-yl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-ethyl-1-(2-ethyl-1-benzofuran-3-yl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 79645567 |
| Molecular Formula | C15H17F4NO |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-ethyl-1-(2-ethyl-1-benzofuran-3-yl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCNC(c1c(CC)oc2ccccc12)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H17F4NO/c1-3-10-12(9-7-5-6-8-11(9)21-10)13(20-4-2)15(18,19)14(16)17/h5-8,13-14,20H,3-4H2,1-2H3 |
| InChIKey | QMBPIBLHFROUTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|