C16H21N3O2 — CID 79645933
ethyl 1-amino-3-(2-methylbenzimidazol-1-yl)cyclopentane-1-carboxylate (PubChem CID 79645933) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 1-amino-3-(2-methylbenzimidazol-1-yl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-amino-3-(2-methylbenzimidazol-1-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79645933 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 1-amino-3-(2-methylbenzimidazol-1-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCC(n2c(C)nc3ccccc32)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-21-15(20)16(17)9-8-12(10-16)19-11(2)18-13-6-4-5-7-14(13)19/h4-7,12H,3,8-10,17H2,1-2H3 |
| InChIKey | LRWDZRJJOMHLID-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |