C14H29N3O3S — CID 79647012
[3-(4-methylsulfonylpiperazin-1-yl)-1-(propan-2-ylamino)cyclopentyl]methanol (PubChem CID 79647012) has the molecular formula C14H29N3O3S and a molecular weight of 319.47 g/mol. Its IUPAC name is [3-(4-methylsulfonylpiperazin-1-yl)-1-(propan-2-ylamino)cyclopentyl]methanol.
| Compound Name | [3-(4-methylsulfonylpiperazin-1-yl)-1-(propan-2-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 79647012 |
| Molecular Formula | C14H29N3O3S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [3-(4-methylsulfonylpiperazin-1-yl)-1-(propan-2-ylamino)cyclopentyl]methanol |
| SMILES | CC(C)NC1(CO)CCC(N2CCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C14H29N3O3S/c1-12(2)15-14(11-18)5-4-13(10-14)16-6-8-17(9-7-16)21(3,19)20/h12-13,15,18H,4-11H2,1-3H3 |
| InChIKey | UOSLNFHGTDRIBG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |