About [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol
[1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol (PubChem CID 79647022) has the molecular formula C14H26F3N3O
and a molecular weight of 309.38 g/mol. Its IUPAC name is [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol |
| PubChem CID | 79647022 |
| Molecular Formula | C14H26F3N3O |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol |
| SMILES | CCNC1(CO)CCC(N2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H26F3N3O/c1-2-18-13(11-21)4-3-12(9-13)20-7-5-19(6-8-20)10-14(15,16)17/h12,18,21H,2-11H2,1H3 |
| InChIKey | YBNVYRITPHFVBZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol?
The IUPAC name of [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol (CID 79647022) is [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol.
What is the SMILES notation for [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol?
The canonical SMILES for [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol is CCNC1(CO)CCC(N2CCN(CC(F)(F)F)CC2)C1.
What is the InChIKey of [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol?
The InChIKey is YBNVYRITPHFVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3N3O/c1-2-18-13(11-21)4-3-12(9-13)20-7-5-19(6-8-20)10-14(15,16)17/h12,18,21H,2-11H2,1H3.
What are the key properties of [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol?
[1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol has a molecular weight of 309.38 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(ethylamino)-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclopentyl]methanol is sourced from PubChem (CID 79647022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).