C12H17IN4O — CID 79648337
1-(cyclopropylamino)-3-(4-iodopyrazol-1-yl)cyclopentane-1-carboxamide (PubChem CID 79648337) has the molecular formula C12H17IN4O and a molecular weight of 360.20 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-(4-iodopyrazol-1-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-(cyclopropylamino)-3-(4-iodopyrazol-1-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79648337 |
| Molecular Formula | C12H17IN4O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1-(cyclopropylamino)-3-(4-iodopyrazol-1-yl)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(NC2CC2)CCC(n2cc(I)cn2)C1 |
| InChI | InChI=1S/C12H17IN4O/c13-8-6-15-17(7-8)10-3-4-12(5-10,11(14)18)16-9-1-2-9/h6-7,9-10,16H,1-5H2,(H2,14,18) |
| InChIKey | CVAVCDUPCFMBKQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|