1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid

C8H12F3NO3 — CID 79648447

IUPAC1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid
SMILESNC1(C(=O)O)CCC(OCC(F)(F)F)C1
InChIInChI=1S/C8H12F3NO3/c9-8(10,11)4-15-5-1-2-7(12,3-5)6(13)14/h5H,1-4,12H2,(H,13,14)
InChIKeyBJJSNPSYFCHXGA-UHFFFAOYSA-N
MW227.18 g/mol
LogP0.90
Rot. Bonds3

About 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid

1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid (PubChem CID 79648447) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid
PubChem CID79648447
Molecular FormulaC8H12F3NO3
Molecular Weight227.18 g/mol
Exact Mass227.08
IUPAC Name1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid
SMILESNC1(C(=O)O)CCC(OCC(F)(F)F)C1
InChIInChI=1S/C8H12F3NO3/c9-8(10,11)4-15-5-1-2-7(12,3-5)6(13)14/h5H,1-4,12H2,(H,13,14)
InChIKeyBJJSNPSYFCHXGA-UHFFFAOYSA-N
XLogP0.90
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.18
LogP ≤ 50.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid (CID 79648447) is 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid is NC1(C(=O)O)CCC(OCC(F)(F)F)C1.
What is the InChIKey of 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid?
The InChIKey is BJJSNPSYFCHXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO3/c9-8(10,11)4-15-5-1-2-7(12,3-5)6(13)14/h5H,1-4,12H2,(H,13,14).
What are the key properties of 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid?
1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid has a molecular weight of 227.18 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 79648447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).