C14H23N3O2 — CID 79648637
1-(ethylamino)-3-(2-propylimidazol-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 79648637) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-(ethylamino)-3-(2-propylimidazol-1-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(ethylamino)-3-(2-propylimidazol-1-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79648637 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-(ethylamino)-3-(2-propylimidazol-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | CCCc1nccn1C1CCC(NCC)(C(=O)O)C1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-5-12-15-8-9-17(12)11-6-7-14(10-11,13(18)19)16-4-2/h8-9,11,16H,3-7,10H2,1-2H3,(H,18,19) |
| InChIKey | HJHBXPLTSRHSQF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |