About ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate
ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate (PubChem CID 79648908) has the molecular formula C13H22F3NO3
and a molecular weight of 297.32 g/mol. Its IUPAC name is ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate |
| PubChem CID | 79648908 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate |
| SMILES | CCCNC1(C(=O)OCC)CCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H22F3NO3/c1-3-7-17-12(11(18)19-4-2)6-5-10(8-12)20-9-13(14,15)16/h10,17H,3-9H2,1-2H3 |
| InChIKey | IOQSJAAAQNQVEF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate?
The IUPAC name of ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate (CID 79648908) is ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate?
The canonical SMILES for ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate is CCCNC1(C(=O)OCC)CCC(OCC(F)(F)F)C1.
What is the InChIKey of ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate?
The InChIKey is IOQSJAAAQNQVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO3/c1-3-7-17-12(11(18)19-4-2)6-5-10(8-12)20-9-13(14,15)16/h10,17H,3-9H2,1-2H3.
What are the key properties of ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate?
ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate has a molecular weight of 297.32 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(propylamino)-3-(2,2,2-trifluoroethoxy)cyclopentane-1-carboxylate is sourced from PubChem (CID 79648908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).