About 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide
3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide (PubChem CID 79649025) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide |
| PubChem CID | 79649025 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide |
| SMILES | Cc1ncn(C2CCC(NC(C)C)(C(N)=O)C2)c1C |
| InChI | InChI=1S/C14H24N4O/c1-9(2)17-14(13(15)19)6-5-12(7-14)18-8-16-10(3)11(18)4/h8-9,12,17H,5-7H2,1-4H3,(H2,15,19) |
| InChIKey | AQUCNQCWROHBIJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide (CID 79649025) is 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide is Cc1ncn(C2CCC(NC(C)C)(C(N)=O)C2)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide?
The InChIKey is AQUCNQCWROHBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O/c1-9(2)17-14(13(15)19)6-5-12(7-14)18-8-16-10(3)11(18)4/h8-9,12,17H,5-7H2,1-4H3,(H2,15,19).
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide?
3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide has a molecular weight of 264.37 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)-1-(propan-2-ylamino)cyclopentane-1-carboxamide is sourced from PubChem (CID 79649025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).