C11H22N4O — CID 79650015
1-amino-3-(4-methylpiperazin-1-yl)cyclopentane-1-carboxamide (PubChem CID 79650015) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-amino-3-(4-methylpiperazin-1-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-amino-3-(4-methylpiperazin-1-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79650015 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1-amino-3-(4-methylpiperazin-1-yl)cyclopentane-1-carboxamide |
| SMILES | CN1CCN(C2CCC(N)(C(N)=O)C2)CC1 |
| InChI | InChI=1S/C11H22N4O/c1-14-4-6-15(7-5-14)9-2-3-11(13,8-9)10(12)16/h9H,2-8,13H2,1H3,(H2,12,16) |
| InChIKey | QAVOZBSGCFFWRO-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |