C13H25N3O3 — CID 79650879
methyl 3-[3-amino-2-(methylamino)-3-oxopropyl]-1-(ethylamino)cyclopentane-1-carboxylate (PubChem CID 79650879) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 3-[3-amino-2-(methylamino)-3-oxopropyl]-1-(ethylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[3-amino-2-(methylamino)-3-oxopropyl]-1-(ethylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79650879 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | methyl 3-[3-amino-2-(methylamino)-3-oxopropyl]-1-(ethylamino)cyclopentane-1-carboxylate |
| SMILES | CCNC1(C(=O)OC)CCC(CC(NC)C(N)=O)C1 |
| InChI | InChI=1S/C13H25N3O3/c1-4-16-13(12(18)19-3)6-5-9(8-13)7-10(15-2)11(14)17/h9-10,15-16H,4-8H2,1-3H3,(H2,14,17) |
| InChIKey | HUJBUYOCEHUFJQ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |