C14H25N3O2 — CID 79651754
3-(4-cyclopropylpiperazin-1-yl)-1-(methylamino)cyclopentane-1-carboxylic acid (PubChem CID 79651754) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-(4-cyclopropylpiperazin-1-yl)-1-(methylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(4-cyclopropylpiperazin-1-yl)-1-(methylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79651754 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-(4-cyclopropylpiperazin-1-yl)-1-(methylamino)cyclopentane-1-carboxylic acid |
| SMILES | CNC1(C(=O)O)CCC(N2CCN(C3CC3)CC2)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-15-14(13(18)19)5-4-12(10-14)17-8-6-16(7-9-17)11-2-3-11/h11-12,15H,2-10H2,1H3,(H,18,19) |
| InChIKey | FKIMIAFWCRTXDK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |