About N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide
N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide (PubChem CID 79652328) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide |
| PubChem CID | 79652328 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H19N3O2S/c1-13(2,9-15)10-16(3)19(17,18)12-6-4-5-11(7-12)8-14/h4-7H,9-10,15H2,1-3H3 |
| InChIKey | MRKOQGHRWKLVHD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide (CID 79652328) is N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide is CN(CC(C)(C)CN)S(=O)(=O)c1cccc(C#N)c1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide?
The InChIKey is MRKOQGHRWKLVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-13(2,9-15)10-16(3)19(17,18)12-6-4-5-11(7-12)8-14/h4-7H,9-10,15H2,1-3H3.
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide?
N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide has a molecular weight of 281.38 g/mol, XLogP of 1.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-3-cyano-N-methylbenzenesulfonamide is sourced from PubChem (CID 79652328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).