C14H20N4O — CID 79652704
1-(3-amino-2,2-dimethylpropyl)-3-(4-cyanophenyl)-1-methylurea (PubChem CID 79652704) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethylpropyl)-3-(4-cyanophenyl)-1-methylurea.
| Compound Name | 1-(3-amino-2,2-dimethylpropyl)-3-(4-cyanophenyl)-1-methylurea |
|---|---|
| PubChem CID | 79652704 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(3-amino-2,2-dimethylpropyl)-3-(4-cyanophenyl)-1-methylurea |
| SMILES | CN(CC(C)(C)CN)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H20N4O/c1-14(2,9-16)10-18(3)13(19)17-12-6-4-11(8-15)5-7-12/h4-7H,9-10,16H2,1-3H3,(H,17,19) |
| InChIKey | SZKPKKCASUNJNF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |