About N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide
N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide (PubChem CID 79653279) has the molecular formula C12H27N3O2S
and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide |
| PubChem CID | 79653279 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H27N3O2S/c1-12(2,10-13)11-14(3)18(16,17)15-8-6-4-5-7-9-15/h4-11,13H2,1-3H3 |
| InChIKey | ZRJRADGBRZQSJZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide (CID 79653279) is N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide is CN(CC(C)(C)CN)S(=O)(=O)N1CCCCCC1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide?
The InChIKey is ZRJRADGBRZQSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O2S/c1-12(2,10-13)11-14(3)18(16,17)15-8-6-4-5-7-9-15/h4-11,13H2,1-3H3.
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide?
N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide has a molecular weight of 277.43 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-N-methylazepane-1-sulfonamide is sourced from PubChem (CID 79653279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).