About methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate
methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate (PubChem CID 79653388) has the molecular formula C14H17F2NO2S
and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate |
| PubChem CID | 79653388 |
| Molecular Formula | C14H17F2NO2S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCC(Sc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C14H17F2NO2S/c1-17-14(13(18)19-2)6-5-10(8-14)20-12-7-9(15)3-4-11(12)16/h3-4,7,10,17H,5-6,8H2,1-2H3 |
| InChIKey | UEGCHGSHTINTMU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate?
The IUPAC name of methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate (CID 79653388) is methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate?
The canonical SMILES for methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate is CNC1(C(=O)OC)CCC(Sc2cc(F)ccc2F)C1.
What is the InChIKey of methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate?
The InChIKey is UEGCHGSHTINTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO2S/c1-17-14(13(18)19-2)6-5-10(8-14)20-12-7-9(15)3-4-11(12)16/h3-4,7,10,17H,5-6,8H2,1-2H3.
What are the key properties of methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate?
methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate has a molecular weight of 301.36 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,5-difluorophenyl)sulfanyl-1-(methylamino)cyclopentane-1-carboxylate is sourced from PubChem (CID 79653388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).