About 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide
1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide (PubChem CID 79656985) has the molecular formula C13H20N4OS
and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide |
| PubChem CID | 79656985 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide |
| SMILES | Cc1nc(SC2CCC(N)(C(N)=O)C2)nc(C)c1C |
| InChI | InChI=1S/C13H20N4OS/c1-7-8(2)16-12(17-9(7)3)19-10-4-5-13(15,6-10)11(14)18/h10H,4-6,15H2,1-3H3,(H2,14,18) |
| InChIKey | LNVNQRSEMMVDKT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide?
The IUPAC name of 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide (CID 79656985) is 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide.
What is the SMILES notation for 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide?
The canonical SMILES for 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide is Cc1nc(SC2CCC(N)(C(N)=O)C2)nc(C)c1C.
What is the InChIKey of 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide?
The InChIKey is LNVNQRSEMMVDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4OS/c1-7-8(2)16-12(17-9(7)3)19-10-4-5-13(15,6-10)11(14)18/h10H,4-6,15H2,1-3H3,(H2,14,18).
What are the key properties of 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide?
1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide has a molecular weight of 280.40 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentane-1-carboxamide is sourced from PubChem (CID 79656985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).