C12H26N2O — CID 79657029
[1-amino-3-[methyl(pentan-3-yl)amino]cyclopentyl]methanol (PubChem CID 79657029) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is [1-amino-3-[methyl(pentan-3-yl)amino]cyclopentyl]methanol.
| Compound Name | [1-amino-3-[methyl(pentan-3-yl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79657029 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | [1-amino-3-[methyl(pentan-3-yl)amino]cyclopentyl]methanol |
| SMILES | CCC(CC)N(C)C1CCC(N)(CO)C1 |
| InChI | InChI=1S/C12H26N2O/c1-4-10(5-2)14(3)11-6-7-12(13,8-11)9-15/h10-11,15H,4-9,13H2,1-3H3 |
| InChIKey | XLSXPGSDTNEHSK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |