C13H18BrNO2S — CID 79657983
2-(5-bromothiophen-2-yl)-1-(4-propan-2-ylmorpholin-2-yl)ethanone (PubChem CID 79657983) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(4-propan-2-ylmorpholin-2-yl)ethanone.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(4-propan-2-ylmorpholin-2-yl)ethanone |
|---|---|
| PubChem CID | 79657983 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(4-propan-2-ylmorpholin-2-yl)ethanone |
| SMILES | CC(C)N1CCOC(C(=O)Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-9(2)15-5-6-17-12(8-15)11(16)7-10-3-4-13(14)18-10/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | XMWIVAVVILZCBH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |