C14H23IN4O — CID 79658035
6-ethyl-5-iodo-N-methyl-2-(4-propylmorpholin-2-yl)pyrimidin-4-amine (PubChem CID 79658035) has the molecular formula C14H23IN4O and a molecular weight of 390.27 g/mol. Its IUPAC name is 6-ethyl-5-iodo-N-methyl-2-(4-propylmorpholin-2-yl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-iodo-N-methyl-2-(4-propylmorpholin-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79658035 |
| Molecular Formula | C14H23IN4O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 6-ethyl-5-iodo-N-methyl-2-(4-propylmorpholin-2-yl)pyrimidin-4-amine |
| SMILES | CCCN1CCOC(c2nc(CC)c(I)c(NC)n2)C1 |
| InChI | InChI=1S/C14H23IN4O/c1-4-6-19-7-8-20-11(9-19)13-17-10(5-2)12(15)14(16-3)18-13/h11H,4-9H2,1-3H3,(H,16,17,18) |
| InChIKey | RGAXUHKUYNMYCP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|