C13H20ClN3 — CID 79658672
(4-chlorophenyl)-(1,4-dimethylpiperazin-2-yl)methanamine (PubChem CID 79658672) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,4-dimethylpiperazin-2-yl)methanamine.
| Compound Name | (4-chlorophenyl)-(1,4-dimethylpiperazin-2-yl)methanamine |
|---|---|
| PubChem CID | 79658672 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (4-chlorophenyl)-(1,4-dimethylpiperazin-2-yl)methanamine |
| SMILES | CN1CCN(C)C(C(N)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H20ClN3/c1-16-7-8-17(2)12(9-16)13(15)10-3-5-11(14)6-4-10/h3-6,12-13H,7-9,15H2,1-2H3 |
| InChIKey | ZCAFTLBDIGXSNM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |