C11H20N2O — CID 79658723
1-(1,4-dimethylpiperazin-2-yl)pent-4-en-1-one (PubChem CID 79658723) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)pent-4-en-1-one.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 79658723 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)pent-4-en-1-one |
| SMILES | C=CCCC(=O)C1CN(C)CCN1C |
| InChI | InChI=1S/C11H20N2O/c1-4-5-6-11(14)10-9-12(2)7-8-13(10)3/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | XKJYVQXYULJCDP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|