C10H6ClF4N3 — CID 79659764
6-chloro-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine (PubChem CID 79659764) has the molecular formula C10H6ClF4N3 and a molecular weight of 279.62 g/mol. Its IUPAC name is 6-chloro-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine.
| Compound Name | 6-chloro-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 79659764 |
| Molecular Formula | C10H6ClF4N3 |
| Molecular Weight | 279.62 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 6-chloro-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine |
| SMILES | Nc1nc(C(F)(F)C(F)F)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H6ClF4N3/c11-4-1-2-6-5(3-4)7(16)18-9(17-6)10(14,15)8(12)13/h1-3,8H,(H2,16,17,18) |
| InChIKey | SUNJODMHZMDKFC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|