C7H3ClF4N4 — CID 79659917
8-chloro-3-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 79659917) has the molecular formula C7H3ClF4N4 and a molecular weight of 254.57 g/mol. Its IUPAC name is 8-chloro-3-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 79659917 |
| Molecular Formula | C7H3ClF4N4 |
| Molecular Weight | 254.57 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 8-chloro-3-(1,1,2,2-tetrafluoroethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | FC(F)C(F)(F)c1nnc2c(Cl)nccn12 |
| InChI | InChI=1S/C7H3ClF4N4/c8-3-4-14-15-6(7(11,12)5(9)10)16(4)2-1-13-3/h1-2,5H |
| InChIKey | YRVHOUSHSGOUJD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|