C12H11F4N3 — CID 79660032
N,6-dimethyl-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine (PubChem CID 79660032) has the molecular formula C12H11F4N3 and a molecular weight of 273.23 g/mol. Its IUPAC name is N,6-dimethyl-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine.
| Compound Name | N,6-dimethyl-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 79660032 |
| Molecular Formula | C12H11F4N3 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N,6-dimethyl-2-(1,1,2,2-tetrafluoroethyl)quinazolin-4-amine |
| SMILES | CNc1nc(C(F)(F)C(F)F)nc2ccc(C)cc12 |
| InChI | InChI=1S/C12H11F4N3/c1-6-3-4-8-7(5-6)9(17-2)19-11(18-8)12(15,16)10(13)14/h3-5,10H,1-2H3,(H,17,18,19) |
| InChIKey | DSBREDUPIHSEGY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|