C9H11F4N3O — CID 79660117
3-piperidin-4-yl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole (PubChem CID 79660117) has the molecular formula C9H11F4N3O and a molecular weight of 253.20 g/mol. Its IUPAC name is 3-piperidin-4-yl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 3-piperidin-4-yl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 79660117 |
| Molecular Formula | C9H11F4N3O |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-piperidin-4-yl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)C(F)(F)c1nc(C2CCNCC2)no1 |
| InChI | InChI=1S/C9H11F4N3O/c10-7(11)9(12,13)8-15-6(16-17-8)5-1-3-14-4-2-5/h5,7,14H,1-4H2 |
| InChIKey | QWFDNRAYGPKTPF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|