C13H15BrF4 — CID 79660734
3-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2,4,5-tetramethylbenzene (PubChem CID 79660734) has the molecular formula C13H15BrF4 and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 79660734 |
| Molecular Formula | C13H15BrF4 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C(Br)C(F)(F)C(F)F)c1C |
| InChI | InChI=1S/C13H15BrF4/c1-6-5-7(2)9(4)10(8(6)3)11(14)13(17,18)12(15)16/h5,11-12H,1-4H3 |
| InChIKey | QDGZYNGBJGKZKF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|