C13H12BrF4NO — CID 79660832
6-(1-bromo-2,2,3,3-tetrafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 79660832) has the molecular formula C13H12BrF4NO and a molecular weight of 354.14 g/mol. Its IUPAC name is 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79660832 |
| Molecular Formula | C13H12BrF4NO |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(Br)C(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C13H12BrF4NO/c1-19-9-4-2-8(6-7(9)3-5-10(19)20)11(14)13(17,18)12(15)16/h2,4,6,11-12H,3,5H2,1H3 |
| InChIKey | ZJFIKUMFFOHLBC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|