C5H5F4N3 — CID 79660902
5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole (PubChem CID 79660902) has the molecular formula C5H5F4N3 and a molecular weight of 183.11 g/mol. Its IUPAC name is 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 79660902 |
| Molecular Formula | C5H5F4N3 |
| Molecular Weight | 183.11 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole |
| SMILES | Cc1nc(C(F)(F)C(F)F)n[nH]1 |
| InChI | InChI=1S/C5H5F4N3/c1-2-10-4(12-11-2)5(8,9)3(6)7/h3H,1H3,(H,10,11,12) |
| InChIKey | JUXFSGGCIIOSBE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.11 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|