C9H5F5N2 — CID 79660905
4-fluoro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole (PubChem CID 79660905) has the molecular formula C9H5F5N2 and a molecular weight of 236.14 g/mol. Its IUPAC name is 4-fluoro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole.
| Compound Name | 4-fluoro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 79660905 |
| Molecular Formula | C9H5F5N2 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-fluoro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole |
| SMILES | Fc1cccc2[nH]c(C(F)(F)C(F)F)nc12 |
| InChI | InChI=1S/C9H5F5N2/c10-4-2-1-3-5-6(4)16-8(15-5)9(13,14)7(11)12/h1-3,7H,(H,15,16) |
| InChIKey | DQISBABABZNEEL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|