C14H11BrF4O — CID 79660923
2-(1-bromo-2,2,3,3-tetrafluoropropyl)-6-methoxynaphthalene (PubChem CID 79660923) has the molecular formula C14H11BrF4O and a molecular weight of 351.14 g/mol. Its IUPAC name is 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-6-methoxynaphthalene.
| Compound Name | 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-6-methoxynaphthalene |
|---|---|
| PubChem CID | 79660923 |
| Molecular Formula | C14H11BrF4O |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-(1-bromo-2,2,3,3-tetrafluoropropyl)-6-methoxynaphthalene |
| SMILES | COc1ccc2cc(C(Br)C(F)(F)C(F)F)ccc2c1 |
| InChI | InChI=1S/C14H11BrF4O/c1-20-11-5-4-8-6-10(3-2-9(8)7-11)12(15)14(18,19)13(16)17/h2-7,12-13H,1H3 |
| InChIKey | FHGXXWPEYXDDMJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|