About 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile
6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile (PubChem CID 79661111) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile |
| PubChem CID | 79661111 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile |
| SMILES | CCN(CC(C)(C)CN)c1cccc(C#N)n1 |
| InChI | InChI=1S/C13H20N4/c1-4-17(10-13(2,3)9-15)12-7-5-6-11(8-14)16-12/h5-7H,4,9-10,15H2,1-3H3 |
| InChIKey | XLXPYCBXEUFWLO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile?
The IUPAC name of 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile (CID 79661111) is 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile.
What is the SMILES notation for 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile?
The canonical SMILES for 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile is CCN(CC(C)(C)CN)c1cccc(C#N)n1.
What is the InChIKey of 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile?
The InChIKey is XLXPYCBXEUFWLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-4-17(10-13(2,3)9-15)12-7-5-6-11(8-14)16-12/h5-7H,4,9-10,15H2,1-3H3.
What are the key properties of 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile?
6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile has a molecular weight of 232.33 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-amino-2,2-dimethylpropyl)-ethylamino]pyridine-2-carbonitrile is sourced from PubChem (CID 79661111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).