About 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one
2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one (PubChem CID 79661672) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one.
Molecular Properties
| Compound Name | 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one |
| PubChem CID | 79661672 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one |
| SMILES | CCCN(Cc1cc(=O)c(O)co1)CC(C)(C)CN |
| InChI | InChI=1S/C14H24N2O3/c1-4-5-16(10-14(2,3)9-15)7-11-6-12(17)13(18)8-19-11/h6,8,18H,4-5,7,9-10,15H2,1-3H3 |
| InChIKey | NHZGKGQUYXJEHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one?
The IUPAC name of 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one (CID 79661672) is 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one.
What is the SMILES notation for 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one?
The canonical SMILES for 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one is CCCN(Cc1cc(=O)c(O)co1)CC(C)(C)CN.
What is the InChIKey of 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one?
The InChIKey is NHZGKGQUYXJEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-4-5-16(10-14(2,3)9-15)7-11-6-12(17)13(18)8-19-11/h6,8,18H,4-5,7,9-10,15H2,1-3H3.
What are the key properties of 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one?
2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one has a molecular weight of 268.36 g/mol, XLogP of 1.54, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3-amino-2,2-dimethylpropyl)-propylamino]methyl]-5-hydroxypyran-4-one is sourced from PubChem (CID 79661672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).