About N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine
N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine (PubChem CID 79662113) has the molecular formula C13H22ClN3
and a molecular weight of 255.79 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine |
| PubChem CID | 79662113 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CC(C)(C)CN)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H22ClN3/c1-4-7-17(10-13(2,3)9-15)12-6-5-11(14)8-16-12/h5-6,8H,4,7,9-10,15H2,1-3H3 |
| InChIKey | KJHYCZYMKICELN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine?
The IUPAC name of N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine (CID 79662113) is N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine?
The canonical SMILES for N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine is CCCN(CC(C)(C)CN)c1ccc(Cl)cn1.
What is the InChIKey of N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine?
The InChIKey is KJHYCZYMKICELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22ClN3/c1-4-7-17(10-13(2,3)9-15)12-6-5-11(14)8-16-12/h5-6,8H,4,7,9-10,15H2,1-3H3.
What are the key properties of N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine?
N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine has a molecular weight of 255.79 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-2-pyridinyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 79662113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).