About [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol
[3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol (PubChem CID 79662691) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol |
| PubChem CID | 79662691 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol |
| SMILES | CC(C)N1CCOC(c2n[nH]c(CO)n2)C1 |
| InChI | InChI=1S/C10H18N4O2/c1-7(2)14-3-4-16-8(5-14)10-11-9(6-15)12-13-10/h7-8,15H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | XJOQXGGMGDUTJT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol?
The IUPAC name of [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol (CID 79662691) is [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol.
What is the SMILES notation for [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol?
The canonical SMILES for [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol is CC(C)N1CCOC(c2n[nH]c(CO)n2)C1.
What is the InChIKey of [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol?
The InChIKey is XJOQXGGMGDUTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2/c1-7(2)14-3-4-16-8(5-14)10-11-9(6-15)12-13-10/h7-8,15H,3-6H2,1-2H3,(H,11,12,13).
What are the key properties of [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol?
[3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol has a molecular weight of 226.28 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-propan-2-ylmorpholin-2-yl)-1H-1,2,4-triazol-5-yl]methanol is sourced from PubChem (CID 79662691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).