C16H24BNO3 — CID 79662775
3-(2-methylidenebutoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 79662775) has the molecular formula C16H24BNO3 and a molecular weight of 289.18 g/mol. Its IUPAC name is 3-(2-methylidenebutoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(2-methylidenebutoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 79662775 |
| Molecular Formula | C16H24BNO3 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-(2-methylidenebutoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | C=C(CC)COc1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H24BNO3/c1-7-12(2)11-19-14-8-13(9-18-10-14)17-20-15(3,4)16(5,6)21-17/h8-10H,2,7,11H2,1,3-6H3 |
| InChIKey | WIFVTRGMBZZQAI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|