C17H25BO3 — CID 79663015
2-[2-(cyclobutyloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 79663015) has the molecular formula C17H25BO3 and a molecular weight of 288.20 g/mol. Its IUPAC name is 2-[2-(cyclobutyloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(cyclobutyloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 79663015 |
| Molecular Formula | C17H25BO3 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-[2-(cyclobutyloxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccccc2COC2CCC2)OC1(C)C |
| InChI | InChI=1S/C17H25BO3/c1-16(2)17(3,4)21-18(20-16)15-11-6-5-8-13(15)12-19-14-9-7-10-14/h5-6,8,11,14H,7,9-10,12H2,1-4H3 |
| InChIKey | CVUXBJVPVHZYMW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|