C15H21N5O — CID 79663687
2-[3-(1,4-dimethylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline (PubChem CID 79663687) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-[3-(1,4-dimethylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline.
| Compound Name | 2-[3-(1,4-dimethylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
|---|---|
| PubChem CID | 79663687 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[3-(1,4-dimethylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
| SMILES | Cc1cccc(N)c1-c1nc(C2CN(C)CCN2C)no1 |
| InChI | InChI=1S/C15H21N5O/c1-10-5-4-6-11(16)13(10)15-17-14(18-21-15)12-9-19(2)7-8-20(12)3/h4-6,12H,7-9,16H2,1-3H3 |
| InChIKey | LECSAPVNNQZBRM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|