About N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide
N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide (PubChem CID 79664554) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide.
Molecular Properties
| Compound Name | N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide |
| PubChem CID | 79664554 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide |
| SMILES | CCN(CC(=O)NC(=O)c1ccccc1)CC(C)(C)CN |
| InChI | InChI=1S/C16H25N3O2/c1-4-19(12-16(2,3)11-17)10-14(20)18-15(21)13-8-6-5-7-9-13/h5-9H,4,10-12,17H2,1-3H3,(H,18,20,21) |
| InChIKey | FUSMKVSZBPIKBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide?
The IUPAC name of N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide (CID 79664554) is N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide.
What is the SMILES notation for N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide?
The canonical SMILES for N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide is CCN(CC(=O)NC(=O)c1ccccc1)CC(C)(C)CN.
What is the InChIKey of N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide?
The InChIKey is FUSMKVSZBPIKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-4-19(12-16(2,3)11-17)10-14(20)18-15(21)13-8-6-5-7-9-13/h5-9H,4,10-12,17H2,1-3H3,(H,18,20,21).
What are the key properties of N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide?
N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide has a molecular weight of 291.39 g/mol, XLogP of 1.25, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]benzamide is sourced from PubChem (CID 79664554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).