About 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline
5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 79665321) has the molecular formula C14H17BrN4O2
and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
Molecular Properties
| Compound Name | 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| PubChem CID | 79665321 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CCN1CCOC(c2noc(-c3ccc(Br)cc3N)n2)C1 |
| InChI | InChI=1S/C14H17BrN4O2/c1-2-19-5-6-20-12(8-19)13-17-14(21-18-13)10-4-3-9(15)7-11(10)16/h3-4,7,12H,2,5-6,8,16H2,1H3 |
| InChIKey | IUTKKFOLZSCFJN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline?
The IUPAC name of 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline (CID 79665321) is 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
What is the SMILES notation for 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline?
The canonical SMILES for 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline is CCN1CCOC(c2noc(-c3ccc(Br)cc3N)n2)C1.
What is the InChIKey of 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline?
The InChIKey is IUTKKFOLZSCFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN4O2/c1-2-19-5-6-20-12(8-19)13-17-14(21-18-13)10-4-3-9(15)7-11(10)16/h3-4,7,12H,2,5-6,8,16H2,1H3.
What are the key properties of 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline?
5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline has a molecular weight of 353.22 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]aniline is sourced from PubChem (CID 79665321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).