C13H19Cl2N3O — CID 79666831
2-(4,6-dichloro-5-propan-2-ylpyrimidin-2-yl)-4-ethylmorpholine (PubChem CID 79666831) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-(4,6-dichloro-5-propan-2-ylpyrimidin-2-yl)-4-ethylmorpholine.
| Compound Name | 2-(4,6-dichloro-5-propan-2-ylpyrimidin-2-yl)-4-ethylmorpholine |
|---|---|
| PubChem CID | 79666831 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(4,6-dichloro-5-propan-2-ylpyrimidin-2-yl)-4-ethylmorpholine |
| SMILES | CCN1CCOC(c2nc(Cl)c(C(C)C)c(Cl)n2)C1 |
| InChI | InChI=1S/C13H19Cl2N3O/c1-4-18-5-6-19-9(7-18)13-16-11(14)10(8(2)3)12(15)17-13/h8-9H,4-7H2,1-3H3 |
| InChIKey | BFKYUNAKPMELFE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |