C14H20FNO2 — CID 79666863
(4-ethylmorpholin-2-yl)-(5-fluoro-2-methylphenyl)methanol (PubChem CID 79666863) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is (4-ethylmorpholin-2-yl)-(5-fluoro-2-methylphenyl)methanol.
| Compound Name | (4-ethylmorpholin-2-yl)-(5-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 79666863 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4-ethylmorpholin-2-yl)-(5-fluoro-2-methylphenyl)methanol |
| SMILES | CCN1CCOC(C(O)c2cc(F)ccc2C)C1 |
| InChI | InChI=1S/C14H20FNO2/c1-3-16-6-7-18-13(9-16)14(17)12-8-11(15)5-4-10(12)2/h4-5,8,13-14,17H,3,6-7,9H2,1-2H3 |
| InChIKey | RZJXBUIZOPKUIH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |