C14H17BrFNO2 — CID 79667003
2-(2-bromo-4-fluorophenyl)-1-(4-ethylmorpholin-2-yl)ethanone (PubChem CID 79667003) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(4-ethylmorpholin-2-yl)ethanone.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(4-ethylmorpholin-2-yl)ethanone |
|---|---|
| PubChem CID | 79667003 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(4-ethylmorpholin-2-yl)ethanone |
| SMILES | CCN1CCOC(C(=O)Cc2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C14H17BrFNO2/c1-2-17-5-6-19-14(9-17)13(18)7-10-3-4-11(16)8-12(10)15/h3-4,8,14H,2,5-7,9H2,1H3 |
| InChIKey | SCEYLVKISJUSSB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |