About 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline
3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline (PubChem CID 79667047) has the molecular formula C15H20N4S
and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline.
Molecular Properties
| Compound Name | 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline |
| PubChem CID | 79667047 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline |
| SMILES | CN1CCN(C)C(c2nc(-c3cccc(N)c3)cs2)C1 |
| InChI | InChI=1S/C15H20N4S/c1-18-6-7-19(2)14(9-18)15-17-13(10-20-15)11-4-3-5-12(16)8-11/h3-5,8,10,14H,6-7,9,16H2,1-2H3 |
| InChIKey | ZEDQZZJJDAWNID-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline?
The IUPAC name of 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline (CID 79667047) is 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline.
What is the SMILES notation for 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline?
The canonical SMILES for 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline is CN1CCN(C)C(c2nc(-c3cccc(N)c3)cs2)C1.
What is the InChIKey of 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline?
The InChIKey is ZEDQZZJJDAWNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4S/c1-18-6-7-19(2)14(9-18)15-17-13(10-20-15)11-4-3-5-12(16)8-11/h3-5,8,10,14H,6-7,9,16H2,1-2H3.
What are the key properties of 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline?
3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline has a molecular weight of 288.42 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,4-dimethylpiperazin-2-yl)-1,3-thiazol-4-yl]aniline is sourced from PubChem (CID 79667047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).