C15H19NO — CID 796671
(1R,6S)-N-(2-methylphenyl)bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 796671) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (1R,6S)-N-(2-methylphenyl)bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6S)-N-(2-methylphenyl)bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 796671 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (1R,6S)-N-(2-methylphenyl)bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C15H19NO/c1-10-6-2-5-9-13(10)16-15(17)14-11-7-3-4-8-12(11)14/h2,5-6,9,11-12,14H,3-4,7-8H2,1H3,(H,16,17)/t11-,12+,14? |
| InChIKey | KDKAQQOPQDYKCS-ONXXMXGDSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |