C12H24N2O — CID 79667596
(E)-N-(3-amino-2,2-dimethylpropyl)-N-propylbut-2-enamide (PubChem CID 79667596) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (E)-N-(3-amino-2,2-dimethylpropyl)-N-propylbut-2-enamide.
| Compound Name | (E)-N-(3-amino-2,2-dimethylpropyl)-N-propylbut-2-enamide |
|---|---|
| PubChem CID | 79667596 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (E)-N-(3-amino-2,2-dimethylpropyl)-N-propylbut-2-enamide |
| SMILES | C/C=C/C(=O)N(CCC)CC(C)(C)CN |
| InChI | InChI=1S/C12H24N2O/c1-5-7-11(15)14(8-6-2)10-12(3,4)9-13/h5,7H,6,8-10,13H2,1-4H3/b7-5+ |
| InChIKey | LHPNCFRRVLJCIP-FNORWQNLSA-N |
| XLogP | 1.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|