C17H28N2O — CID 79667849
N-(3-amino-2,2-dimethylpropyl)-2,4-dimethyl-N-propylbenzamide (PubChem CID 79667849) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2,4-dimethyl-N-propylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2,4-dimethyl-N-propylbenzamide |
|---|---|
| PubChem CID | 79667849 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2,4-dimethyl-N-propylbenzamide |
| SMILES | CCCN(CC(C)(C)CN)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C17H28N2O/c1-6-9-19(12-17(4,5)11-18)16(20)15-8-7-13(2)10-14(15)3/h7-8,10H,6,9,11-12,18H2,1-5H3 |
| InChIKey | JPEHXIXXFPKCPO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |