About N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide
N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide (PubChem CID 79668101) has the molecular formula C11H21N3O2S
and a molecular weight of 259.37 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide |
| PubChem CID | 79668101 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide |
| SMILES | CCN(CC(C)(C)CN)S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C11H21N3O2S/c1-4-14(9-11(2,3)8-12)17(15,16)10-5-6-13-7-10/h5-7,13H,4,8-9,12H2,1-3H3 |
| InChIKey | YRGMKAMOQAFBLK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide (CID 79668101) is N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide is CCN(CC(C)(C)CN)S(=O)(=O)c1cc[nH]c1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide?
The InChIKey is YRGMKAMOQAFBLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2S/c1-4-14(9-11(2,3)8-12)17(15,16)10-5-6-13-7-10/h5-7,13H,4,8-9,12H2,1-3H3.
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide?
N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide has a molecular weight of 259.37 g/mol, XLogP of 1.01, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-N-ethyl-1H-pyrrole-3-sulfonamide is sourced from PubChem (CID 79668101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).