2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid

C11H24N2O4S — CID 79668616

IUPAC2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid
SMILESCCCN(CC(C)(C)CN)S(=O)(=O)C(C)C(=O)O
InChIInChI=1S/C11H24N2O4S/c1-5-6-13(8-11(3,4)7-12)18(16,17)9(2)10(14)15/h9H,5-8,12H2,1-4H3,(H,14,15)
InChIKeyVYZAELPNCUJBKH-UHFFFAOYSA-N
MW280.39 g/mol
LogP0.49
Rot. Bonds8

About 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid

2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid (PubChem CID 79668616) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid.

Molecular Properties

Compound Name2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid
PubChem CID79668616
Molecular FormulaC11H24N2O4S
Molecular Weight280.39 g/mol
Exact Mass280.15
IUPAC Name2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid
SMILESCCCN(CC(C)(C)CN)S(=O)(=O)C(C)C(=O)O
InChIInChI=1S/C11H24N2O4S/c1-5-6-13(8-11(3,4)7-12)18(16,17)9(2)10(14)15/h9H,5-8,12H2,1-4H3,(H,14,15)
InChIKeyVYZAELPNCUJBKH-UHFFFAOYSA-N
XLogP0.49
TPSA100.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.39
LogP ≤ 50.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid?
The IUPAC name of 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid (CID 79668616) is 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid.
What is the SMILES notation for 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid?
The canonical SMILES for 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid is CCCN(CC(C)(C)CN)S(=O)(=O)C(C)C(=O)O.
What is the InChIKey of 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid?
The InChIKey is VYZAELPNCUJBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O4S/c1-5-6-13(8-11(3,4)7-12)18(16,17)9(2)10(14)15/h9H,5-8,12H2,1-4H3,(H,14,15).
What are the key properties of 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid?
2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid has a molecular weight of 280.39 g/mol, XLogP of 0.49, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-2,2-dimethylpropyl)-propylsulfamoyl]propanoic acid is sourced from PubChem (CID 79668616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).