C17H9F5N2O — CID 7966899
(E)-N-benzyl-2-cyano-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 7966899) has the molecular formula C17H9F5N2O and a molecular weight of 352.26 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7966899 |
| Molecular Formula | C17H9F5N2O |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(F)c(F)c(F)c(F)c1F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H9F5N2O/c18-12-11(13(19)15(21)16(22)14(12)20)6-10(7-23)17(25)24-8-9-4-2-1-3-5-9/h1-6H,8H2,(H,24,25)/b10-6+ |
| InChIKey | YDMUYNICUBIHTD-UXBLZVDNSA-N |
| XLogP | 3.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|